C24H14Br2Cl3N3O3S — CID 137144797
2-[2,6-dibromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 137144797) has the molecular formula C24H14Br2Cl3N3O3S and a molecular weight of 690.63 g/mol. Its IUPAC name is 2-[2,6-dibromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[2,6-dibromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 137144797 |
| Molecular Formula | C24H14Br2Cl3N3O3S |
| Molecular Weight | 690.63 g/mol |
| Exact Mass | 686.82 |
| IUPAC Name | 2-[2,6-dibromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]phenoxy]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(COc1c(Br)cc(/C=C2/S/C(=N\c3ccc(Cl)cc3)NC2=O)cc1Br)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H14Br2Cl3N3O3S/c25-16-7-12(9-20-23(34)32-24(36-20)31-14-3-1-13(27)2-4-14)8-17(26)22(16)35-11-21(33)30-15-5-6-18(28)19(29)10-15/h1-10H,11H2,(H,30,33)(H,31,32,34)/b20-9+ |
| InChIKey | HXZSIINFVAZREJ-AWQFTUOYSA-N |
| XLogP | 8.08 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.63 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|