C26H19BrCl3N3O4S — CID 137144886
2-[2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3,4-dichlorophenyl)acetamide (PubChem CID 137144886) has the molecular formula C26H19BrCl3N3O4S and a molecular weight of 655.79 g/mol. Its IUPAC name is 2-[2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3,4-dichlorophenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 137144886 |
| Molecular Formula | C26H19BrCl3N3O4S |
| Molecular Weight | 655.79 g/mol |
| Exact Mass | 652.93 |
| IUPAC Name | 2-[2-bromo-4-[(E)-[2-(4-chlorophenyl)imino-4-oxo-1,3-thiazolidin-5-ylidene]methyl]-6-ethoxyphenoxy]-N-(3,4-dichlorophenyl)acetamide |
| SMILES | CCOc1cc(/C=C2/S/C(=N\c3ccc(Cl)cc3)NC2=O)cc(Br)c1OCC(=O)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H19BrCl3N3O4S/c1-2-36-21-10-14(11-22-25(35)33-26(38-22)32-16-5-3-15(28)4-6-16)9-18(27)24(21)37-13-23(34)31-17-7-8-19(29)20(30)12-17/h3-12H,2,13H2,1H3,(H,31,34)(H,32,33,35)/b22-11+ |
| InChIKey | XFWJNHTWYPYADG-SSDVNMTOSA-N |
| XLogP | 7.72 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.79 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|