C32H25Br2ClN2O4S — CID 137070857
(5E)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one (PubChem CID 137070857) has the molecular formula C32H25Br2ClN2O4S and a molecular weight of 728.89 g/mol. Its IUPAC name is (5E)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one.
| Compound Name | (5E)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 137070857 |
| Molecular Formula | C32H25Br2ClN2O4S |
| Molecular Weight | 728.89 g/mol |
| Exact Mass | 725.96 |
| IUPAC Name | (5E)-2-(4-chlorophenyl)imino-5-[[3,5-dibromo-4-[(3-ethoxy-4-phenylmethoxyphenyl)methoxy]phenyl]methylidene]-1,3-thiazolidin-4-one |
| SMILES | CCOc1cc(COc2c(Br)cc(/C=C3/S/C(=N\c4ccc(Cl)cc4)NC3=O)cc2Br)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H25Br2ClN2O4S/c1-2-39-28-16-21(8-13-27(28)40-18-20-6-4-3-5-7-20)19-41-30-25(33)14-22(15-26(30)34)17-29-31(38)37-32(42-29)36-24-11-9-23(35)10-12-24/h3-17H,2,18-19H2,1H3,(H,36,37,38)/b29-17+ |
| InChIKey | GKWRHPBNSYTVTJ-STBIYBPSSA-N |
| XLogP | 9.31 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.89 |
| LogP ≤ 5 | 9.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|