C24H18N2O3S — CID 126107334
2-[[2-methoxy-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzonitrile (PubChem CID 126107334) has the molecular formula C24H18N2O3S and a molecular weight of 414.49 g/mol. Its IUPAC name is 2-[[2-methoxy-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzonitrile.
| Compound Name | 2-[[2-methoxy-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzonitrile |
|---|---|
| PubChem CID | 126107334 |
| Molecular Formula | C24H18N2O3S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | 2-[[2-methoxy-4-[(Z)-(3-oxo-4H-1,4-benzothiazin-2-ylidene)methyl]phenoxy]methyl]benzonitrile |
| SMILES | COc1cc(/C=C2\Sc3ccccc3NC2=O)ccc1OCc1ccccc1C#N |
| InChI | InChI=1S/C24H18N2O3S/c1-28-21-12-16(13-23-24(27)26-19-8-4-5-9-22(19)30-23)10-11-20(21)29-15-18-7-3-2-6-17(18)14-25/h2-13H,15H2,1H3,(H,26,27)/b23-13- |
| InChIKey | OEOCBGBFCFQWKB-QRVIBDJDSA-N |
| XLogP | 5.23 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|