C23H17Cl2NO3S — CID 126100744
(2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126100744) has the molecular formula C23H17Cl2NO3S and a molecular weight of 458.37 g/mol. Its IUPAC name is (2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126100744 |
| Molecular Formula | C23H17Cl2NO3S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.03 |
| IUPAC Name | (2Z)-2-[[4-[(3,4-dichlorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3NC2=O)ccc1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H17Cl2NO3S/c1-28-20-11-14(12-22-23(27)26-18-4-2-3-5-21(18)30-22)7-9-19(20)29-13-15-6-8-16(24)17(25)10-15/h2-12H,13H2,1H3,(H,26,27)/b22-12- |
| InChIKey | DNEGGFIBPIGNSS-UUYOSTAYSA-N |
| XLogP | 6.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|