C23H18FNO3S — CID 126106860
(2Z)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126106860) has the molecular formula C23H18FNO3S and a molecular weight of 407.47 g/mol. Its IUPAC name is (2Z)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126106860 |
| Molecular Formula | C23H18FNO3S |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.10 |
| IUPAC Name | (2Z)-2-[[4-[(4-fluorophenyl)methoxy]-3-methoxyphenyl]methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3NC2=O)ccc1OCc1ccc(F)cc1 |
| InChI | InChI=1S/C23H18FNO3S/c1-27-20-12-16(8-11-19(20)28-14-15-6-9-17(24)10-7-15)13-22-23(26)25-18-4-2-3-5-21(18)29-22/h2-13H,14H2,1H3,(H,25,26)/b22-13- |
| InChIKey | UCDJDLVMFYBFQF-XKZIYDEJSA-N |
| XLogP | 5.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|