C19H19NO3S — CID 126090554
(2Z)-2-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 126090554) has the molecular formula C19H19NO3S and a molecular weight of 341.43 g/mol. Its IUPAC name is (2Z)-2-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-2-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 126090554 |
| Molecular Formula | C19H19NO3S |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | (2Z)-2-[(3-methoxy-4-propan-2-yloxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1cc(/C=C2\Sc3ccccc3NC2=O)ccc1OC(C)C |
| InChI | InChI=1S/C19H19NO3S/c1-12(2)23-15-9-8-13(10-16(15)22-3)11-18-19(21)20-14-6-4-5-7-17(14)24-18/h4-12H,1-3H3,(H,20,21)/b18-11- |
| InChIKey | AISASWBRHFWBNB-WQRHYEAKSA-N |
| XLogP | 4.57 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|