C18H14NO5S- — CID 3703378
2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate (PubChem CID 3703378) has the molecular formula C18H14NO5S- and a molecular weight of 356.38 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
|---|---|
| PubChem CID | 3703378 |
| Molecular Formula | C18H14NO5S- |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.06 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carboxylate |
| SMILES | COc1ccc(C=C2Sc3ccc(C(=O)[O-])cc3NC2=O)cc1OC |
| InChI | InChI=1S/C18H15NO5S/c1-23-13-5-3-10(7-14(13)24-2)8-16-17(20)19-12-9-11(18(21)22)4-6-15(12)25-16/h3-9H,1-2H3,(H,19,20)(H,21,22)/p-1 |
| InChIKey | IJYCCEGEWYHHMM-UHFFFAOYSA-M |
| XLogP | 2.15 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|