C30H30N2O4S — CID 4155224
6-(4-benzylpiperidine-1-carbonyl)-2-[(3,4-dimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one (PubChem CID 4155224) has the molecular formula C30H30N2O4S and a molecular weight of 514.65 g/mol. Its IUPAC name is 6-(4-benzylpiperidine-1-carbonyl)-2-[(3,4-dimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-(4-benzylpiperidine-1-carbonyl)-2-[(3,4-dimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4155224 |
| Molecular Formula | C30H30N2O4S |
| Molecular Weight | 514.65 g/mol |
| Exact Mass | 514.19 |
| IUPAC Name | 6-(4-benzylpiperidine-1-carbonyl)-2-[(3,4-dimethoxyphenyl)methylidene]-4H-1,4-benzothiazin-3-one |
| SMILES | COc1ccc(C=C2Sc3ccc(C(=O)N4CCC(Cc5ccccc5)CC4)cc3NC2=O)cc1OC |
| InChI | InChI=1S/C30H30N2O4S/c1-35-25-10-8-22(17-26(25)36-2)18-28-29(33)31-24-19-23(9-11-27(24)37-28)30(34)32-14-12-21(13-15-32)16-20-6-4-3-5-7-20/h3-11,17-19,21H,12-16H2,1-2H3,(H,31,33) |
| InChIKey | AFLUKJJOTSMHQB-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.65 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|