C25H27N3O6S — CID 4155230
ethyl 4-[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]piperazine-1-carboxylate (PubChem CID 4155230) has the molecular formula C25H27N3O6S and a molecular weight of 497.57 g/mol. Its IUPAC name is ethyl 4-[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 4155230 |
| Molecular Formula | C25H27N3O6S |
| Molecular Weight | 497.57 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | ethyl 4-[2-[(3,4-dimethoxyphenyl)methylidene]-3-oxo-4H-1,4-benzothiazine-6-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)c2ccc3c(c2)NC(=O)C(=Cc2ccc(OC)c(OC)c2)S3)CC1 |
| InChI | InChI=1S/C25H27N3O6S/c1-4-34-25(31)28-11-9-27(10-12-28)24(30)17-6-8-21-18(15-17)26-23(29)22(35-21)14-16-5-7-19(32-2)20(13-16)33-3/h5-8,13-15H,4,9-12H2,1-3H3,(H,26,29) |
| InChIKey | JJLMQRVTGFNERM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|