C31H33N3O4S — CID 4117738
6-(4-benzylpiperazine-1-carbonyl)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-methyl-1,4-benzothiazin-3-one (PubChem CID 4117738) has the molecular formula C31H33N3O4S and a molecular weight of 543.69 g/mol. Its IUPAC name is 6-(4-benzylpiperazine-1-carbonyl)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-methyl-1,4-benzothiazin-3-one.
| Compound Name | 6-(4-benzylpiperazine-1-carbonyl)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-methyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4117738 |
| Molecular Formula | C31H33N3O4S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.22 |
| IUPAC Name | 6-(4-benzylpiperazine-1-carbonyl)-2-[(4-ethoxy-3-methoxyphenyl)methylidene]-4-methyl-1,4-benzothiazin-3-one |
| SMILES | CCOc1ccc(C=C2Sc3ccc(C(=O)N4CCN(Cc5ccccc5)CC4)cc3N(C)C2=O)cc1OC |
| InChI | InChI=1S/C31H33N3O4S/c1-4-38-26-12-10-23(18-27(26)37-3)19-29-31(36)32(2)25-20-24(11-13-28(25)39-29)30(35)34-16-14-33(15-17-34)21-22-8-6-5-7-9-22/h5-13,18-20H,4,14-17,21H2,1-3H3 |
| InChIKey | JVRADJNFHAFXFN-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|