C22H21ClN2O2S — CID 6621704
2-[(3-chlorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one (PubChem CID 6621704) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-[(3-chlorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-[(3-chlorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 6621704 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(3-chlorophenyl)methylidene]-4-methyl-6-(piperidine-1-carbonyl)-1,4-benzothiazin-3-one |
| SMILES | CN1C(=O)C(=Cc2cccc(Cl)c2)Sc2ccc(C(=O)N3CCCCC3)cc21 |
| InChI | InChI=1S/C22H21ClN2O2S/c1-24-18-14-16(21(26)25-10-3-2-4-11-25)8-9-19(18)28-20(22(24)27)13-15-6-5-7-17(23)12-15/h5-9,12-14H,2-4,10-11H2,1H3 |
| InChIKey | APCFBQSXAMMDLP-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|