C29H29N3O2S — CID 46250285
(2Z)-6-(4-benzylpiperazine-1-carbonyl)-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one (PubChem CID 46250285) has the molecular formula C29H29N3O2S and a molecular weight of 483.64 g/mol. Its IUPAC name is (2Z)-6-(4-benzylpiperazine-1-carbonyl)-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one.
| Compound Name | (2Z)-6-(4-benzylpiperazine-1-carbonyl)-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46250285 |
| Molecular Formula | C29H29N3O2S |
| Molecular Weight | 483.64 g/mol |
| Exact Mass | 483.20 |
| IUPAC Name | (2Z)-6-(4-benzylpiperazine-1-carbonyl)-4-methyl-2-[(3-methylphenyl)methylidene]-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(/C=C2\Sc3ccc(C(=O)N4CCN(Cc5ccccc5)CC4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C29H29N3O2S/c1-21-7-6-10-23(17-21)18-27-29(34)30(2)25-19-24(11-12-26(25)35-27)28(33)32-15-13-31(14-16-32)20-22-8-4-3-5-9-22/h3-12,17-19H,13-16,20H2,1-2H3/b27-18- |
| InChIKey | IYZNTTBCWJTXNQ-IMRQLAEWSA-N |
| XLogP | 5.06 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.64 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|