C24H26N2O2S — CID 6621763
4-methyl-2-[(3-methylphenyl)methylidene]-6-(4-methylpiperidine-1-carbonyl)-1,4-benzothiazin-3-one (PubChem CID 6621763) has the molecular formula C24H26N2O2S and a molecular weight of 406.55 g/mol. Its IUPAC name is 4-methyl-2-[(3-methylphenyl)methylidene]-6-(4-methylpiperidine-1-carbonyl)-1,4-benzothiazin-3-one.
| Compound Name | 4-methyl-2-[(3-methylphenyl)methylidene]-6-(4-methylpiperidine-1-carbonyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 6621763 |
| Molecular Formula | C24H26N2O2S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | 4-methyl-2-[(3-methylphenyl)methylidene]-6-(4-methylpiperidine-1-carbonyl)-1,4-benzothiazin-3-one |
| SMILES | Cc1cccc(C=C2Sc3ccc(C(=O)N4CCC(C)CC4)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C24H26N2O2S/c1-16-9-11-26(12-10-16)23(27)19-7-8-21-20(15-19)25(3)24(28)22(29-21)14-18-6-4-5-17(2)13-18/h4-8,13-16H,9-12H2,1-3H3 |
| InChIKey | LEMSZSXAKGYTII-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|