C30H34N2O2S — CID 171153637
N-[1-(1-adamantyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 171153637) has the molecular formula C30H34N2O2S and a molecular weight of 486.68 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 171153637 |
| Molecular Formula | C30H34N2O2S |
| Molecular Weight | 486.68 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-4-methyl-2-[(3-methylphenyl)methylidene]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(C=C2Sc3ccc(C(=O)NC(C)C45CC6CC(CC(C6)C4)C5)cc3N(C)C2=O)c1 |
| InChI | InChI=1S/C30H34N2O2S/c1-18-5-4-6-20(9-18)13-27-29(34)32(3)25-14-24(7-8-26(25)35-27)28(33)31-19(2)30-15-21-10-22(16-30)12-23(11-21)17-30/h4-9,13-14,19,21-23H,10-12,15-17H2,1-3H3,(H,31,33) |
| InChIKey | OSUSDZBIHVWPSR-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.68 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|