C36H38N2O2S — CID 171153630
N-[1-(1-adamantyl)ethyl]-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide (PubChem CID 171153630) has the molecular formula C36H38N2O2S and a molecular weight of 562.78 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 171153630 |
| Molecular Formula | C36H38N2O2S |
| Molecular Weight | 562.78 g/mol |
| Exact Mass | 562.27 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)C(=Cc3ccccc3)Sc3ccc(C(=O)NC(C)C45CC6CC(CC(C6)C4)C5)cc32)c1 |
| InChI | InChI=1S/C36H38N2O2S/c1-23-7-6-10-26(13-23)22-38-31-18-30(11-12-32(31)41-33(35(38)40)17-25-8-4-3-5-9-25)34(39)37-24(2)36-19-27-14-28(20-36)16-29(15-27)21-36/h3-13,17-18,24,27-29H,14-16,19-22H2,1-2H3,(H,37,39) |
| InChIKey | PEWVWEZPIHLTDH-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.78 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|