C32H28N2O2S — CID 6159753
(2Z)-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-N-(1-phenylethyl)-1,4-benzothiazine-6-carboxamide (PubChem CID 6159753) has the molecular formula C32H28N2O2S and a molecular weight of 504.66 g/mol. Its IUPAC name is (2Z)-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-N-(1-phenylethyl)-1,4-benzothiazine-6-carboxamide.
| Compound Name | (2Z)-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-N-(1-phenylethyl)-1,4-benzothiazine-6-carboxamide |
|---|---|
| PubChem CID | 6159753 |
| Molecular Formula | C32H28N2O2S |
| Molecular Weight | 504.66 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | (2Z)-2-benzylidene-4-[(3-methylphenyl)methyl]-3-oxo-N-(1-phenylethyl)-1,4-benzothiazine-6-carboxamide |
| SMILES | Cc1cccc(CN2C(=O)/C(=C/c3ccccc3)Sc3ccc(C(=O)NC(C)c4ccccc4)cc32)c1 |
| InChI | InChI=1S/C32H28N2O2S/c1-22-10-9-13-25(18-22)21-34-28-20-27(31(35)33-23(2)26-14-7-4-8-15-26)16-17-29(28)37-30(32(34)36)19-24-11-5-3-6-12-24/h3-20,23H,21H2,1-2H3,(H,33,35)/b30-19- |
| InChIKey | FYEAYXUDTAFPOX-FSGOGVSDSA-N |
| XLogP | 7.17 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|