C33H30N2O2S — CID 92666996
4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[(1S)-1-phenylethyl]benzamide (PubChem CID 92666996) has the molecular formula C33H30N2O2S and a molecular weight of 518.68 g/mol. Its IUPAC name is 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[(1S)-1-phenylethyl]benzamide.
| Compound Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[(1S)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 92666996 |
| Molecular Formula | C33H30N2O2S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[(1S)-1-phenylethyl]benzamide |
| SMILES | Cc1ccc(C)c(CN2C(=O)/C(=C/c3ccc(C(=O)N[C@@H](C)c4ccccc4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C33H30N2O2S/c1-22-13-14-23(2)28(19-22)21-35-29-11-7-8-12-30(29)38-31(33(35)37)20-25-15-17-27(18-16-25)32(36)34-24(3)26-9-5-4-6-10-26/h4-20,24H,21H2,1-3H3,(H,34,36)/b31-20-/t24-/m0/s1 |
| InChIKey | PFFXNCPRXVQFPG-PVWQUUJCSA-N |
| XLogP | 7.47 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|