C30H26N2O3S — CID 46258788
4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 46258788) has the molecular formula C30H26N2O3S and a molecular weight of 494.62 g/mol. Its IUPAC name is 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 46258788 |
| Molecular Formula | C30H26N2O3S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.17 |
| IUPAC Name | 4-[(Z)-[4-[(2,5-dimethylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(C)c(CN2C(=O)/C(=C/c3ccc(C(=O)NCc4ccco4)cc3)Sc3ccccc32)c1 |
| InChI | InChI=1S/C30H26N2O3S/c1-20-9-10-21(2)24(16-20)19-32-26-7-3-4-8-27(26)36-28(30(32)34)17-22-11-13-23(14-12-22)29(33)31-18-25-6-5-15-35-25/h3-17H,18-19H2,1-2H3,(H,31,33)/b28-17- |
| InChIKey | KHRQBYZKBTVUFM-QRQIAZFYSA-N |
| XLogP | 6.51 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|