C32H32N2O2S — CID 46374274
N-[2-(cyclohexen-1-yl)ethyl]-4-[(E)-[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46374274) has the molecular formula C32H32N2O2S and a molecular weight of 508.69 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[(E)-[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[(E)-[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46374274 |
| Molecular Formula | C32H32N2O2S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.22 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[(E)-[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | Cc1ccccc1CN1C(=O)/C(=C\c2ccc(C(=O)NCCC3=CCCCC3)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C32H32N2O2S/c1-23-9-5-6-12-27(23)22-34-28-13-7-8-14-29(28)37-30(32(34)36)21-25-15-17-26(18-16-25)31(35)33-20-19-24-10-3-2-4-11-24/h5-10,12-18,21H,2-4,11,19-20,22H2,1H3,(H,33,35)/b30-21+ |
| InChIKey | KCICFFFTOBCHEC-MWAVMZGNSA-N |
| XLogP | 7.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|