C34H39N3O2S — CID 67379129
N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 67379129) has the molecular formula C34H39N3O2S and a molecular weight of 553.77 g/mol. Its IUPAC name is N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 67379129 |
| Molecular Formula | C34H39N3O2S |
| Molecular Weight | 553.77 g/mol |
| Exact Mass | 553.28 |
| IUPAC Name | N-[3-(2-ethylpiperidin-1-yl)propyl]-4-[[4-[(2-methylphenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | CCC1CCCCN1CCCNC(=O)c1ccc(C=C2Sc3ccccc3N(Cc3ccccc3C)C2=O)cc1 |
| InChI | InChI=1S/C34H39N3O2S/c1-3-29-13-8-9-21-36(29)22-10-20-35-33(38)27-18-16-26(17-19-27)23-32-34(39)37(24-28-12-5-4-11-25(28)2)30-14-6-7-15-31(30)40-32/h4-7,11-12,14-19,23,29H,3,8-10,13,20-22,24H2,1-2H3,(H,35,38) |
| InChIKey | MACYPRSWFHEMQG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.77 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|