C32H33FN2O2S2 — CID 5164809
N-(3-cyclohexylsulfanylpropyl)-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 5164809) has the molecular formula C32H33FN2O2S2 and a molecular weight of 560.76 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 5164809 |
| Molecular Formula | C32H33FN2O2S2 |
| Molecular Weight | 560.76 g/mol |
| Exact Mass | 560.20 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | O=C(NCCCSC1CCCCC1)c1ccc(C=C2Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C32H33FN2O2S2/c33-27-12-5-4-9-25(27)22-35-28-13-6-7-14-29(28)39-30(32(35)37)21-23-15-17-24(18-16-23)31(36)34-19-8-20-38-26-10-2-1-3-11-26/h4-7,9,12-18,21,26H,1-3,8,10-11,19-20,22H2,(H,34,36) |
| InChIKey | RBEPAYSDSSFRDP-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.76 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|