C35H33FN3O2S+ — CID 5048283
4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]benzamide (PubChem CID 5048283) has the molecular formula C35H33FN3O2S+ and a molecular weight of 578.73 g/mol. Its IUPAC name is 4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]benzamide.
| Compound Name | 4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]benzamide |
|---|---|
| PubChem CID | 5048283 |
| Molecular Formula | C35H33FN3O2S+ |
| Molecular Weight | 578.73 g/mol |
| Exact Mass | 578.23 |
| IUPAC Name | 4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[3-(1,2,3,4-tetrahydroisoquinolin-2-ium-2-yl)propyl]benzamide |
| SMILES | O=C(NCCC[NH+]1CCc2ccccc2C1)c1ccc(C=C2Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C35H32FN3O2S/c36-30-11-4-3-10-29(30)24-39-31-12-5-6-13-32(31)42-33(35(39)41)22-25-14-16-27(17-15-25)34(40)37-19-7-20-38-21-18-26-8-1-2-9-28(26)23-38/h1-6,8-17,22H,7,18-21,23-24H2,(H,37,40)/p+1 |
| InChIKey | USZLHPFXKRZXHI-UHFFFAOYSA-O |
| XLogP | 5.27 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.73 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|