C30H31FN2O2S2 — CID 46372735
N-(3-butylsulfanylpropyl)-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46372735) has the molecular formula C30H31FN2O2S2 and a molecular weight of 534.72 g/mol. Its IUPAC name is N-(3-butylsulfanylpropyl)-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-(3-butylsulfanylpropyl)-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46372735 |
| Molecular Formula | C30H31FN2O2S2 |
| Molecular Weight | 534.72 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | N-(3-butylsulfanylpropyl)-4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | CCCCSCCCNC(=O)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C30H31FN2O2S2/c1-2-3-18-36-19-6-17-32-29(34)24-13-9-22(10-14-24)20-28-30(35)33(21-23-11-15-25(31)16-12-23)26-7-4-5-8-27(26)37-28/h4-5,7-16,20H,2-3,6,17-19,21H2,1H3,(H,32,34)/b28-20- |
| InChIKey | LDZHNNJSXRPVGZ-RRAHZORUSA-N |
| XLogP | 7.16 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.72 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|