C29H29FN2O2S2 — CID 6257575
4-[(E)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-propylsulfanylpropyl)benzamide (PubChem CID 6257575) has the molecular formula C29H29FN2O2S2 and a molecular weight of 520.70 g/mol. Its IUPAC name is 4-[(E)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-propylsulfanylpropyl)benzamide.
| Compound Name | 4-[(E)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-propylsulfanylpropyl)benzamide |
|---|---|
| PubChem CID | 6257575 |
| Molecular Formula | C29H29FN2O2S2 |
| Molecular Weight | 520.70 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 4-[(E)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-propylsulfanylpropyl)benzamide |
| SMILES | CCCSCCCNC(=O)c1ccc(/C=C2/Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C29H29FN2O2S2/c1-2-17-35-18-7-16-31-28(33)22-14-12-21(13-15-22)19-27-29(34)32(20-23-8-3-4-9-24(23)30)25-10-5-6-11-26(25)36-27/h3-6,8-15,19H,2,7,16-18,20H2,1H3,(H,31,33)/b27-19+ |
| InChIKey | DJTUVOHOSBIFGT-ZXVVBBHZSA-N |
| XLogP | 6.77 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.70 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|