C31H29FN2O2S — CID 46249985
N-[2-(cyclohexen-1-yl)ethyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide (PubChem CID 46249985) has the molecular formula C31H29FN2O2S and a molecular weight of 512.65 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
|---|---|
| PubChem CID | 46249985 |
| Molecular Formula | C31H29FN2O2S |
| Molecular Weight | 512.65 g/mol |
| Exact Mass | 512.19 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzamide |
| SMILES | O=C(NCCC1=CCCCC1)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C31H29FN2O2S/c32-26-11-5-4-10-25(26)21-34-27-12-6-7-13-28(27)37-29(31(34)36)20-23-14-16-24(17-15-23)30(35)33-19-18-22-8-2-1-3-9-22/h4-8,10-17,20H,1-3,9,18-19,21H2,(H,33,35)/b29-20- |
| InChIKey | MNHOHTLOXAWQOW-BRPDVVIDSA-N |
| XLogP | 7.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.65 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|