C27H25FN2O3S — CID 46249986
4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-methoxypropyl)benzamide (PubChem CID 46249986) has the molecular formula C27H25FN2O3S and a molecular weight of 476.57 g/mol. Its IUPAC name is 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-methoxypropyl)benzamide.
| Compound Name | 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-methoxypropyl)benzamide |
|---|---|
| PubChem CID | 46249986 |
| Molecular Formula | C27H25FN2O3S |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(3-methoxypropyl)benzamide |
| SMILES | COCCCNC(=O)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C27H25FN2O3S/c1-33-16-6-15-29-26(31)20-13-11-19(12-14-20)17-25-27(32)30(18-21-7-2-3-8-22(21)28)23-9-4-5-10-24(23)34-25/h2-5,7-14,17H,6,15-16,18H2,1H3,(H,29,31)/b25-17- |
| InChIKey | NXESPKJRRRZJHW-UQQQWYQISA-N |
| XLogP | 5.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|