C28H25FN2O3S — CID 92657017
4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 92657017) has the molecular formula C28H25FN2O3S and a molecular weight of 488.58 g/mol. Its IUPAC name is 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 92657017 |
| Molecular Formula | C28H25FN2O3S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | 4-[(Z)-[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@H]1CCCO1)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccccc3F)C2=O)cc1 |
| InChI | InChI=1S/C28H25FN2O3S/c29-23-8-2-1-6-21(23)18-31-24-9-3-4-10-25(24)35-26(28(31)33)16-19-11-13-20(14-12-19)27(32)30-17-22-7-5-15-34-22/h1-4,6,8-14,16,22H,5,7,15,17-18H2,(H,30,32)/b26-16-/t22-/m1/s1 |
| InChIKey | FMCUQMCFIPPXKO-JMTCZITHSA-N |
| XLogP | 5.41 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|