C29H26FN3O3S — CID 3316262
1-[4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]piperidine-4-carboxamide (PubChem CID 3316262) has the molecular formula C29H26FN3O3S and a molecular weight of 515.61 g/mol. Its IUPAC name is 1-[4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 3316262 |
| Molecular Formula | C29H26FN3O3S |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.17 |
| IUPAC Name | 1-[4-[[4-[(2-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)c2ccc(C=C3Sc4ccccc4N(Cc4ccccc4F)C3=O)cc2)CC1 |
| InChI | InChI=1S/C29H26FN3O3S/c30-23-6-2-1-5-22(23)18-33-24-7-3-4-8-25(24)37-26(29(33)36)17-19-9-11-21(12-10-19)28(35)32-15-13-20(14-16-32)27(31)34/h1-12,17,20H,13-16,18H2,(H2,31,34) |
| InChIKey | DHIQGKDEMPLMBD-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|