C23H23N3O3S — CID 5020548
1-[2-(2-benzylidene-3-oxo-1,4-benzothiazin-4-yl)acetyl]piperidine-4-carboxamide (PubChem CID 5020548) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[2-(2-benzylidene-3-oxo-1,4-benzothiazin-4-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | 1-[2-(2-benzylidene-3-oxo-1,4-benzothiazin-4-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 5020548 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 1-[2-(2-benzylidene-3-oxo-1,4-benzothiazin-4-yl)acetyl]piperidine-4-carboxamide |
| SMILES | NC(=O)C1CCN(C(=O)CN2C(=O)C(=Cc3ccccc3)Sc3ccccc32)CC1 |
| InChI | InChI=1S/C23H23N3O3S/c24-22(28)17-10-12-25(13-11-17)21(27)15-26-18-8-4-5-9-19(18)30-20(23(26)29)14-16-6-2-1-3-7-16/h1-9,14,17H,10-13,15H2,(H2,24,28) |
| InChIKey | ZVLGOSHKNVBJFN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|