C21H20N2O2S — CID 4215951
2-benzylidene-4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzothiazin-3-one (PubChem CID 4215951) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-benzylidene-4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzothiazin-3-one.
| Compound Name | 2-benzylidene-4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 4215951 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-benzylidene-4-(2-oxo-2-pyrrolidin-1-ylethyl)-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)C(=Cc2ccccc2)Sc2ccccc21)N1CCCC1 |
| InChI | InChI=1S/C21H20N2O2S/c24-20(22-12-6-7-13-22)15-23-17-10-4-5-11-18(17)26-19(21(23)25)14-16-8-2-1-3-9-16/h1-5,8-11,14H,6-7,12-13,15H2 |
| InChIKey | MPLOMSZPOXDWCW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|