C26H21BrN2O2S — CID 46372943
(2E)-2-[(3-bromophenyl)methylidene]-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,4-benzothiazin-3-one (PubChem CID 46372943) has the molecular formula C26H21BrN2O2S and a molecular weight of 505.44 g/mol. Its IUPAC name is (2E)-2-[(3-bromophenyl)methylidene]-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,4-benzothiazin-3-one.
| Compound Name | (2E)-2-[(3-bromophenyl)methylidene]-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 46372943 |
| Molecular Formula | C26H21BrN2O2S |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 504.05 |
| IUPAC Name | (2E)-2-[(3-bromophenyl)methylidene]-4-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoethyl]-1,4-benzothiazin-3-one |
| SMILES | O=C(CN1C(=O)/C(=C\c2cccc(Br)c2)Sc2ccccc21)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C26H21BrN2O2S/c27-21-9-5-6-18(14-21)15-24-26(31)29(22-10-3-4-11-23(22)32-24)17-25(30)28-13-12-19-7-1-2-8-20(19)16-28/h1-11,14-15H,12-13,16-17H2/b24-15+ |
| InChIKey | LBZHMOHGCZEQSS-BUVRLJJBSA-N |
| XLogP | 5.51 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|