C24H26BrN3O2S — CID 92657281
2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]acetamide (PubChem CID 92657281) has the molecular formula C24H26BrN3O2S and a molecular weight of 500.46 g/mol. Its IUPAC name is 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]acetamide.
| Compound Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]acetamide |
|---|---|
| PubChem CID | 92657281 |
| Molecular Formula | C24H26BrN3O2S |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 499.09 |
| IUPAC Name | 2-[(2E)-2-[(3-bromophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[[(2S)-1-ethylpyrrolidin-2-yl]methyl]acetamide |
| SMILES | CCN1CCC[C@H]1CNC(=O)CN1C(=O)/C(=C\c2cccc(Br)c2)Sc2ccccc21 |
| InChI | InChI=1S/C24H26BrN3O2S/c1-2-27-12-6-9-19(27)15-26-23(29)16-28-20-10-3-4-11-21(20)31-22(24(28)30)14-17-7-5-8-18(25)13-17/h3-5,7-8,10-11,13-14,19H,2,6,9,12,15-16H2,1H3,(H,26,29)/b22-14+/t19-/m0/s1 |
| InChIKey | WXAQHMLFVLJRRB-KWJZBXMYSA-N |
| XLogP | 4.53 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|