C26H30ClN3O2S — CID 92657349
2-[(2E)-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide (PubChem CID 92657349) has the molecular formula C26H30ClN3O2S and a molecular weight of 484.07 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide.
| Compound Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide |
|---|---|
| PubChem CID | 92657349 |
| Molecular Formula | C26H30ClN3O2S |
| Molecular Weight | 484.07 g/mol |
| Exact Mass | 483.17 |
| IUPAC Name | 2-[(2E)-2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[3-[(3R)-3-methylpiperidin-1-yl]propyl]acetamide |
| SMILES | C[C@@H]1CCCN(CCCNC(=O)CN2C(=O)/C(=C\c3ccc(Cl)cc3)Sc3ccccc32)C1 |
| InChI | InChI=1S/C26H30ClN3O2S/c1-19-6-4-14-29(17-19)15-5-13-28-25(31)18-30-22-7-2-3-8-23(22)33-24(26(30)32)16-20-9-11-21(27)12-10-20/h2-3,7-12,16,19H,4-6,13-15,17-18H2,1H3,(H,28,31)/b24-16+/t19-/m1/s1 |
| InChIKey | XMYICNOLINTOCE-GXDFBKAQSA-N |
| XLogP | 5.06 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.07 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|