C30H33ClN3O2S+ — CID 4128035
benzyl-[3-[[2-[2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetyl]amino]propyl]-propan-2-ylazanium (PubChem CID 4128035) has the molecular formula C30H33ClN3O2S+ and a molecular weight of 535.13 g/mol. Its IUPAC name is benzyl-[3-[[2-[2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetyl]amino]propyl]-propan-2-ylazanium.
| Compound Name | benzyl-[3-[[2-[2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetyl]amino]propyl]-propan-2-ylazanium |
|---|---|
| PubChem CID | 4128035 |
| Molecular Formula | C30H33ClN3O2S+ |
| Molecular Weight | 535.13 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | benzyl-[3-[[2-[2-[(4-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetyl]amino]propyl]-propan-2-ylazanium |
| SMILES | CC(C)[NH+](CCCNC(=O)CN1C(=O)C(=Cc2ccc(Cl)cc2)Sc2ccccc21)Cc1ccccc1 |
| InChI | InChI=1S/C30H32ClN3O2S/c1-22(2)33(20-24-9-4-3-5-10-24)18-8-17-32-29(35)21-34-26-11-6-7-12-27(26)37-28(30(34)36)19-23-13-15-25(31)16-14-23/h3-7,9-16,19,22H,8,17-18,20-21H2,1-2H3,(H,32,35)/p+1 |
| InChIKey | XZPIKJDBQVTAMP-UHFFFAOYSA-O |
| XLogP | 4.82 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.13 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|