C28H34N2O2S2 — CID 46372885
N-(3-cyclohexylsulfanylpropyl)-2-[(2Z)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46372885) has the molecular formula C28H34N2O2S2 and a molecular weight of 494.73 g/mol. Its IUPAC name is N-(3-cyclohexylsulfanylpropyl)-2-[(2Z)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(3-cyclohexylsulfanylpropyl)-2-[(2Z)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46372885 |
| Molecular Formula | C28H34N2O2S2 |
| Molecular Weight | 494.73 g/mol |
| Exact Mass | 494.21 |
| IUPAC Name | N-(3-cyclohexylsulfanylpropyl)-2-[(2Z)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CCc1ccc(/C=C2\Sc3ccccc3N(CC(=O)NCCCSC3CCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C28H34N2O2S2/c1-2-21-13-15-22(16-14-21)19-26-28(32)30(24-11-6-7-12-25(24)34-26)20-27(31)29-17-8-18-33-23-9-4-3-5-10-23/h6-7,11-16,19,23H,2-5,8-10,17-18,20H2,1H3,(H,29,31)/b26-19- |
| InChIKey | HZJSYCFEHDAECD-XHPQRKPJSA-N |
| XLogP | 6.30 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.73 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|