C26H30N2O2S — CID 92657385
2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S,2R)-2-methylcyclohexyl]acetamide (PubChem CID 92657385) has the molecular formula C26H30N2O2S and a molecular weight of 434.61 g/mol. Its IUPAC name is 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S,2R)-2-methylcyclohexyl]acetamide.
| Compound Name | 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
|---|---|
| PubChem CID | 92657385 |
| Molecular Formula | C26H30N2O2S |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.20 |
| IUPAC Name | 2-[(2E)-2-[(4-ethylphenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S,2R)-2-methylcyclohexyl]acetamide |
| SMILES | CCc1ccc(/C=C2/Sc3ccccc3N(CC(=O)N[C@H]3CCCC[C@H]3C)C2=O)cc1 |
| InChI | InChI=1S/C26H30N2O2S/c1-3-19-12-14-20(15-13-19)16-24-26(30)28(22-10-6-7-11-23(22)31-24)17-25(29)27-21-9-5-4-8-18(21)2/h6-7,10-16,18,21H,3-5,8-9,17H2,1-2H3,(H,27,29)/b24-16+/t18-,21+/m1/s1 |
| InChIKey | YNZUHQZVVOGLKQ-LWTMIWEOSA-N |
| XLogP | 5.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|