C22H21ClN2O2S — CID 46251016
2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-cyclopentylacetamide (PubChem CID 46251016) has the molecular formula C22H21ClN2O2S and a molecular weight of 412.94 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-cyclopentylacetamide.
| Compound Name | 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-cyclopentylacetamide |
|---|---|
| PubChem CID | 46251016 |
| Molecular Formula | C22H21ClN2O2S |
| Molecular Weight | 412.94 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-cyclopentylacetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2ccccc2Cl)Sc2ccccc21)NC1CCCC1 |
| InChI | InChI=1S/C22H21ClN2O2S/c23-17-10-4-1-7-15(17)13-20-22(27)25(18-11-5-6-12-19(18)28-20)14-21(26)24-16-8-2-3-9-16/h1,4-7,10-13,16H,2-3,8-9,14H2,(H,24,26)/b20-13+ |
| InChIKey | QLQMNDQAZWOCIV-DEDYPNTBSA-N |
| XLogP | 4.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.94 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|