C25H21ClN2O2S — CID 92657358
2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S)-1-phenylethyl]acetamide (PubChem CID 92657358) has the molecular formula C25H21ClN2O2S and a molecular weight of 448.98 g/mol. Its IUPAC name is 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S)-1-phenylethyl]acetamide.
| Compound Name | 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S)-1-phenylethyl]acetamide |
|---|---|
| PubChem CID | 92657358 |
| Molecular Formula | C25H21ClN2O2S |
| Molecular Weight | 448.98 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | 2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]-N-[(1S)-1-phenylethyl]acetamide |
| SMILES | C[C@H](NC(=O)CN1C(=O)/C(=C\c2ccccc2Cl)Sc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C25H21ClN2O2S/c1-17(18-9-3-2-4-10-18)27-24(29)16-28-21-13-7-8-14-22(21)31-23(25(28)30)15-19-11-5-6-12-20(19)26/h2-15,17H,16H2,1H3,(H,27,29)/b23-15+/t17-/m0/s1 |
| InChIKey | UGYPSCJWFQGFCG-BDFKGGEMSA-N |
| XLogP | 5.70 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.98 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|