C29H29ClN2O3S — CID 46373097
N-[1-(4-butoxyphenyl)ethyl]-2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46373097) has the molecular formula C29H29ClN2O3S and a molecular weight of 521.08 g/mol. Its IUPAC name is N-[1-(4-butoxyphenyl)ethyl]-2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-[1-(4-butoxyphenyl)ethyl]-2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46373097 |
| Molecular Formula | C29H29ClN2O3S |
| Molecular Weight | 521.08 g/mol |
| Exact Mass | 520.16 |
| IUPAC Name | N-[1-(4-butoxyphenyl)ethyl]-2-[(2E)-2-[(2-chlorophenyl)methylidene]-3-oxo-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CCCCOc1ccc(C(C)NC(=O)CN2C(=O)/C(=C\c3ccccc3Cl)Sc3ccccc32)cc1 |
| InChI | InChI=1S/C29H29ClN2O3S/c1-3-4-17-35-23-15-13-21(14-16-23)20(2)31-28(33)19-32-25-11-7-8-12-26(25)36-27(29(32)34)18-22-9-5-6-10-24(22)30/h5-16,18,20H,3-4,17,19H2,1-2H3,(H,31,33)/b27-18+ |
| InChIKey | SKGMNKKCUAHLEL-OVVQPSECSA-N |
| XLogP | 6.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.08 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|