C31H25FN2O2S — CID 46250019
4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(1-phenylethyl)benzamide (PubChem CID 46250019) has the molecular formula C31H25FN2O2S and a molecular weight of 508.62 g/mol. Its IUPAC name is 4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(1-phenylethyl)benzamide.
| Compound Name | 4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(1-phenylethyl)benzamide |
|---|---|
| PubChem CID | 46250019 |
| Molecular Formula | C31H25FN2O2S |
| Molecular Weight | 508.62 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 4-[(Z)-[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]-N-(1-phenylethyl)benzamide |
| SMILES | CC(NC(=O)c1ccc(/C=C2\Sc3ccccc3N(Cc3ccc(F)cc3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H25FN2O2S/c1-21(24-7-3-2-4-8-24)33-30(35)25-15-11-22(12-16-25)19-29-31(36)34(20-23-13-17-26(32)18-14-23)27-9-5-6-10-28(27)37-29/h2-19,21H,20H2,1H3,(H,33,35)/b29-19- |
| InChIKey | YYYBJCYJAJIGIU-CEUNXORHSA-N |
| XLogP | 7.00 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.62 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|