C23H15FNO3S- — CID 3621378
4-[[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoate (PubChem CID 3621378) has the molecular formula C23H15FNO3S- and a molecular weight of 404.44 g/mol. Its IUPAC name is 4-[[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoate.
| Compound Name | 4-[[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoate |
|---|---|
| PubChem CID | 3621378 |
| Molecular Formula | C23H15FNO3S- |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 4-[[4-[(4-fluorophenyl)methyl]-3-oxo-1,4-benzothiazin-2-ylidene]methyl]benzoate |
| SMILES | O=C([O-])c1ccc(C=C2Sc3ccccc3N(Cc3ccc(F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C23H16FNO3S/c24-18-11-7-16(8-12-18)14-25-19-3-1-2-4-20(19)29-21(22(25)26)13-15-5-9-17(10-6-15)23(27)28/h1-13H,14H2,(H,27,28)/p-1 |
| InChIKey | QVQFMJIMZBGKPV-UHFFFAOYSA-M |
| XLogP | 3.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|