C26H21FN2O3S — CID 93002144
4-[(Z)-[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[(1R)-1-phenylethyl]benzamide (PubChem CID 93002144) has the molecular formula C26H21FN2O3S and a molecular weight of 460.53 g/mol. Its IUPAC name is 4-[(Z)-[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[(1R)-1-phenylethyl]benzamide.
| Compound Name | 4-[(Z)-[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[(1R)-1-phenylethyl]benzamide |
|---|---|
| PubChem CID | 93002144 |
| Molecular Formula | C26H21FN2O3S |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.13 |
| IUPAC Name | 4-[(Z)-[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]-N-[(1R)-1-phenylethyl]benzamide |
| SMILES | C[C@@H](NC(=O)c1ccc(/C=C2\SC(=O)N(Cc3cccc(F)c3)C2=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H21FN2O3S/c1-17(20-7-3-2-4-8-20)28-24(30)21-12-10-18(11-13-21)15-23-25(31)29(26(32)33-23)16-19-6-5-9-22(27)14-19/h2-15,17H,16H2,1H3,(H,28,30)/b23-15-/t17-/m1/s1 |
| InChIKey | UVPYTYAOMZOTAU-XMSCMFJESA-N |
| XLogP | 5.55 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|