C27H29FN4O4S — CID 75140295
2-[4-[4-[[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide (PubChem CID 75140295) has the molecular formula C27H29FN4O4S and a molecular weight of 524.62 g/mol. Its IUPAC name is 2-[4-[4-[[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide.
| Compound Name | 2-[4-[4-[[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 75140295 |
| Molecular Formula | C27H29FN4O4S |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.19 |
| IUPAC Name | 2-[4-[4-[[3-[(3-fluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperazin-1-yl]-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)CN1CCN(C(=O)c2ccc(C=C3SC(=O)N(Cc4cccc(F)c4)C3=O)cc2)CC1 |
| InChI | InChI=1S/C27H29FN4O4S/c1-18(2)29-24(33)17-30-10-12-31(13-11-30)25(34)21-8-6-19(7-9-21)15-23-26(35)32(27(36)37-23)16-20-4-3-5-22(28)14-20/h3-9,14-15,18H,10-13,16-17H2,1-2H3,(H,29,33) |
| InChIKey | XBVJDZXIBOIAFL-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|