C27H23FN4O3S — CID 46074242
(5Z)-3-[(3-fluorophenyl)methyl]-5-[[3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 46074242) has the molecular formula C27H23FN4O3S and a molecular weight of 502.57 g/mol. Its IUPAC name is (5Z)-3-[(3-fluorophenyl)methyl]-5-[[3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-3-[(3-fluorophenyl)methyl]-5-[[3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 46074242 |
| Molecular Formula | C27H23FN4O3S |
| Molecular Weight | 502.57 g/mol |
| Exact Mass | 502.15 |
| IUPAC Name | (5Z)-3-[(3-fluorophenyl)methyl]-5-[[3-(4-pyridin-2-ylpiperazine-1-carbonyl)phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C(c1cccc(/C=C2\SC(=O)N(Cc3cccc(F)c3)C2=O)c1)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C27H23FN4O3S/c28-22-8-4-6-20(16-22)18-32-26(34)23(36-27(32)35)17-19-5-3-7-21(15-19)25(33)31-13-11-30(12-14-31)24-9-1-2-10-29-24/h1-10,15-17H,11-14,18H2/b23-17- |
| InChIKey | ICNNZUZFRAEBIE-QJOMJCCJSA-N |
| XLogP | 4.42 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.57 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|