C30H27F2N3O3S — CID 75140426
3-[(2,4-difluorophenyl)methyl]-5-[[3-[4-(1-phenylethyl)piperazine-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione (PubChem CID 75140426) has the molecular formula C30H27F2N3O3S and a molecular weight of 547.63 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl]-5-[[3-[4-(1-phenylethyl)piperazine-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(2,4-difluorophenyl)methyl]-5-[[3-[4-(1-phenylethyl)piperazine-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 75140426 |
| Molecular Formula | C30H27F2N3O3S |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.17 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl]-5-[[3-[4-(1-phenylethyl)piperazine-1-carbonyl]phenyl]methylidene]-1,3-thiazolidine-2,4-dione |
| SMILES | CC(c1ccccc1)N1CCN(C(=O)c2cccc(C=C3SC(=O)N(Cc4ccc(F)cc4F)C3=O)c2)CC1 |
| InChI | InChI=1S/C30H27F2N3O3S/c1-20(22-7-3-2-4-8-22)33-12-14-34(15-13-33)28(36)23-9-5-6-21(16-23)17-27-29(37)35(30(38)39-27)19-24-10-11-25(31)18-26(24)32/h2-11,16-18,20H,12-15,19H2,1H3 |
| InChIKey | YGAIGJWUCYLGLE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|