C26H24F2N2O5S — CID 42871381
ethyl 1-[3-[(Z)-[3-[(2,4-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate (PubChem CID 42871381) has the molecular formula C26H24F2N2O5S and a molecular weight of 514.55 g/mol. Its IUPAC name is ethyl 1-[3-[(Z)-[3-[(2,4-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[3-[(Z)-[3-[(2,4-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 42871381 |
| Molecular Formula | C26H24F2N2O5S |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | ethyl 1-[3-[(Z)-[3-[(2,4-difluorophenyl)methyl]-2,4-dioxo-1,3-thiazolidin-5-ylidene]methyl]benzoyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)c2cccc(/C=C3\SC(=O)N(Cc4ccc(F)cc4F)C3=O)c2)C1 |
| InChI | InChI=1S/C26H24F2N2O5S/c1-2-35-25(33)19-7-4-10-29(14-19)23(31)17-6-3-5-16(11-17)12-22-24(32)30(26(34)36-22)15-18-8-9-20(27)13-21(18)28/h3,5-6,8-9,11-13,19H,2,4,7,10,14-15H2,1H3/b22-12- |
| InChIKey | LLNMUSVCGKIXLS-UUYOSTAYSA-N |
| XLogP | 4.62 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|