C24H23FN2O4S — CID 93002175
(5Z)-5-[[3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione (PubChem CID 93002175) has the molecular formula C24H23FN2O4S and a molecular weight of 454.52 g/mol. Its IUPAC name is (5Z)-5-[[3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione.
| Compound Name | (5Z)-5-[[3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 93002175 |
| Molecular Formula | C24H23FN2O4S |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | (5Z)-5-[[3-[(2S,6S)-2,6-dimethylmorpholine-4-carbonyl]phenyl]methylidene]-3-[(2-fluorophenyl)methyl]-1,3-thiazolidine-2,4-dione |
| SMILES | C[C@H]1CN(C(=O)c2cccc(/C=C3\SC(=O)N(Cc4ccccc4F)C3=O)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C24H23FN2O4S/c1-15-12-26(13-16(2)31-15)22(28)18-8-5-6-17(10-18)11-21-23(29)27(24(30)32-21)14-19-7-3-4-9-20(19)25/h3-11,15-16H,12-14H2,1-2H3/b21-11-/t15-,16-/m0/s1 |
| InChIKey | MTJVWBOJSULURJ-YLHNTRDPSA-N |
| XLogP | 4.31 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|