C24H23F3N2O2S — CID 46251057
N-cyclohexyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide (PubChem CID 46251057) has the molecular formula C24H23F3N2O2S and a molecular weight of 460.52 g/mol. Its IUPAC name is N-cyclohexyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-cyclohexyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 46251057 |
| Molecular Formula | C24H23F3N2O2S |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.14 |
| IUPAC Name | N-cyclohexyl-2-[(2E)-3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
| SMILES | O=C(CN1C(=O)/C(=C\c2ccc(C(F)(F)F)cc2)Sc2ccccc21)NC1CCCCC1 |
| InChI | InChI=1S/C24H23F3N2O2S/c25-24(26,27)17-12-10-16(11-13-17)14-21-23(31)29(19-8-4-5-9-20(19)32-21)15-22(30)28-18-6-2-1-3-7-18/h4-5,8-14,18H,1-3,6-7,15H2,(H,28,30)/b21-14+ |
| InChIKey | ZOGVTCQCRWNYAN-KGENOOAVSA-N |
| XLogP | 5.63 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|