C23H23F3N2O2S — CID 3470976
N-(3-methylbutyl)-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide (PubChem CID 3470976) has the molecular formula C23H23F3N2O2S and a molecular weight of 448.51 g/mol. Its IUPAC name is N-(3-methylbutyl)-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide.
| Compound Name | N-(3-methylbutyl)-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
|---|---|
| PubChem CID | 3470976 |
| Molecular Formula | C23H23F3N2O2S |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.14 |
| IUPAC Name | N-(3-methylbutyl)-2-[3-oxo-2-[[4-(trifluoromethyl)phenyl]methylidene]-1,4-benzothiazin-4-yl]acetamide |
| SMILES | CC(C)CCNC(=O)CN1C(=O)C(=Cc2ccc(C(F)(F)F)cc2)Sc2ccccc21 |
| InChI | InChI=1S/C23H23F3N2O2S/c1-15(2)11-12-27-21(29)14-28-18-5-3-4-6-19(18)31-20(22(28)30)13-16-7-9-17(10-8-16)23(24,25)26/h3-10,13,15H,11-12,14H2,1-2H3,(H,27,29) |
| InChIKey | WLAOZXYMLDBLRZ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|